C14H13N5OS — CID 50744730
1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-quinolin-2-ylurea (PubChem CID 50744730) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-quinolin-2-ylurea.
| Compound Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-quinolin-2-ylurea |
|---|---|
| PubChem CID | 50744730 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-quinolin-2-ylurea |
| SMILES | CCc1nnc(NC(=O)Nc2ccc3ccccc3n2)s1 |
| InChI | InChI=1S/C14H13N5OS/c1-2-12-18-19-14(21-12)17-13(20)16-11-8-7-9-5-3-4-6-10(9)15-11/h3-8H,2H2,1H3,(H2,15,16,17,19,20) |
| InChIKey | KXKNPVUSVOEJOL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |