C21H20N4O3 — CID 53277010
1-[(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)methyl]-3-quinolin-6-ylurea (PubChem CID 53277010) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)methyl]-3-quinolin-6-ylurea.
| Compound Name | 1-[(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)methyl]-3-quinolin-6-ylurea |
|---|---|
| PubChem CID | 53277010 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)methyl]-3-quinolin-6-ylurea |
| SMILES | O=C(NCN1C(=O)C2C3C=CC(CC3)C2C1=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H20N4O3/c26-19-17-12-3-4-13(6-5-12)18(17)20(27)25(19)11-23-21(28)24-15-7-8-16-14(10-15)2-1-9-22-16/h1-4,7-10,12-13,17-18H,5-6,11H2,(H2,23,24,28) |
| InChIKey | GVSKRHLWAREZEI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|