About 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea
1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea (PubChem CID 50740498) has the molecular formula C26H20N4O3
and a molecular weight of 436.47 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea.
Molecular Properties
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea |
| PubChem CID | 50740498 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea |
| SMILES | O=C(NCC(c1ccccc1)N1C(=O)c2ccccc2C1=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H20N4O3/c31-24-20-10-4-5-11-21(20)25(32)30(24)23(17-7-2-1-3-8-17)16-28-26(33)29-19-12-13-22-18(15-19)9-6-14-27-22/h1-15,23H,16H2,(H2,28,29,33) |
| InChIKey | ZCMCIIGGZFTZGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea?
The IUPAC name of 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea (CID 50740498) is 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea.
What is the SMILES notation for 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea?
The canonical SMILES for 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea is O=C(NCC(c1ccccc1)N1C(=O)c2ccccc2C1=O)Nc1ccc2ncccc2c1.
What is the InChIKey of 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea?
The InChIKey is ZCMCIIGGZFTZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O3/c31-24-20-10-4-5-11-21(20)25(32)30(24)23(17-7-2-1-3-8-17)16-28-26(33)29-19-12-13-22-18(15-19)9-6-14-27-22/h1-15,23H,16H2,(H2,28,29,33).
What are the key properties of 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea?
1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea has a molecular weight of 436.47 g/mol, XLogP of 4.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-quinolin-6-ylurea is sourced from PubChem (CID 50740498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).