C23H18N4O5 — CID 50740594
1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-(3-nitrophenyl)urea (PubChem CID 50740594) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 50740594 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)-2-phenylethyl]-3-(3-nitrophenyl)urea |
| SMILES | O=C(NCC(c1ccccc1)N1C(=O)c2ccccc2C1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N4O5/c28-21-18-11-4-5-12-19(18)22(29)26(21)20(15-7-2-1-3-8-15)14-24-23(30)25-16-9-6-10-17(13-16)27(31)32/h1-13,20H,14H2,(H2,24,25,30) |
| InChIKey | JUMZCRIQPZJIES-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|