C20H20N8O8 — CID 122394482
1-(3-nitrophenyl)-3-[[5-[[(3-nitrophenyl)carbamoylamino]methyl]-3,6-dioxopiperazin-2-yl]methyl]urea (PubChem CID 122394482) has the molecular formula C20H20N8O8 and a molecular weight of 500.43 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-[[5-[[(3-nitrophenyl)carbamoylamino]methyl]-3,6-dioxopiperazin-2-yl]methyl]urea.
| Compound Name | 1-(3-nitrophenyl)-3-[[5-[[(3-nitrophenyl)carbamoylamino]methyl]-3,6-dioxopiperazin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 122394482 |
| Molecular Formula | C20H20N8O8 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 1-(3-nitrophenyl)-3-[[5-[[(3-nitrophenyl)carbamoylamino]methyl]-3,6-dioxopiperazin-2-yl]methyl]urea |
| SMILES | O=C(NCC1NC(=O)C(CNC(=O)Nc2cccc([N+](=O)[O-])c2)NC1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N8O8/c29-17-15(9-21-19(31)23-11-3-1-5-13(7-11)27(33)34)25-18(30)16(26-17)10-22-20(32)24-12-4-2-6-14(8-12)28(35)36/h1-8,15-16H,9-10H2,(H,25,30)(H,26,29)(H2,21,23,31)(H2,22,24,32) |
| InChIKey | WLUXGVQBEAGDBE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 226.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|