C16H15N3O5 — CID 39972974
1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(3-nitrophenyl)urea (PubChem CID 39972974) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 39972974 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(3-nitrophenyl)urea |
| SMILES | O=C(NC[C@H]1COc2ccccc2O1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O5/c20-16(18-11-4-3-5-12(8-11)19(21)22)17-9-13-10-23-14-6-1-2-7-15(14)24-13/h1-8,13H,9-10H2,(H2,17,18,20)/t13-/m0/s1 |
| InChIKey | BPJVOHBRUKUWLA-ZDUSSCGKSA-N |
| XLogP | 2.56 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|