C16H15BrN2O3 — CID 108870211
1-(3-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea (PubChem CID 108870211) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 108870211 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea |
| SMILES | O=C(NCC1COc2ccccc2O1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-11-4-3-5-12(8-11)19-16(20)18-9-13-10-21-14-6-1-2-7-15(14)22-13/h1-8,13H,9-10H2,(H2,18,19,20) |
| InChIKey | SKRYIPRKDVWIJP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |