C20H24N2O5 — CID 51118838
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[3-(2-methoxyethoxymethyl)phenyl]urea (PubChem CID 51118838) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[3-(2-methoxyethoxymethyl)phenyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[3-(2-methoxyethoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 51118838 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[3-(2-methoxyethoxymethyl)phenyl]urea |
| SMILES | COCCOCc1cccc(NC(=O)NCC2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-24-9-10-25-13-15-5-4-6-16(11-15)22-20(23)21-12-17-14-26-18-7-2-3-8-19(18)27-17/h2-8,11,17H,9-10,12-14H2,1H3,(H2,21,22,23) |
| InChIKey | OUJSWQQPXDEMPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|