C17H24N2O6 — CID 108528652
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N',N'-bis(2-methoxyethyl)oxamide (PubChem CID 108528652) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N',N'-bis(2-methoxyethyl)oxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N',N'-bis(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108528652 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N',N'-bis(2-methoxyethyl)oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C17H24N2O6/c1-22-9-7-19(8-10-23-2)17(21)16(20)18-11-13-12-24-14-5-3-4-6-15(14)25-13/h3-6,13H,7-12H2,1-2H3,(H,18,20) |
| InChIKey | AFHOQYOZSVHPSO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|