C14H18N2O4 — CID 34566020
N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N'-propan-2-yloxamide (PubChem CID 34566020) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N'-propan-2-yloxamide.
| Compound Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 34566020 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C14H18N2O4/c1-9(2)16-14(18)13(17)15-7-10-8-19-11-5-3-4-6-12(11)20-10/h3-6,9-10H,7-8H2,1-2H3,(H,15,17)(H,16,18)/t10-/m0/s1 |
| InChIKey | CIBVHXZQSUIJJX-JTQLQIEISA-N |
| XLogP | 0.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|