C18H24N2O4 — CID 108525087
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(2-methylcyclohexyl)oxamide (PubChem CID 108525087) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(2-methylcyclohexyl)oxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(2-methylcyclohexyl)oxamide |
|---|---|
| PubChem CID | 108525087 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(2-methylcyclohexyl)oxamide |
| SMILES | CC1CCCCC1NC(=O)C(=O)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C18H24N2O4/c1-12-6-2-3-7-14(12)20-18(22)17(21)19-10-13-11-23-15-8-4-5-9-16(15)24-13/h4-5,8-9,12-14H,2-3,6-7,10-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | FGZGIXMIZXKYNF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|