C15H20N2O5 — CID 108526396
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(1-hydroxybutan-2-yl)oxamide (PubChem CID 108526396) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526396 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C15H20N2O5/c1-2-10(8-18)17-15(20)14(19)16-7-11-9-21-12-5-3-4-6-13(12)22-11/h3-6,10-11,18H,2,7-9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | HGVGPIVCUFGCDS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|