C16H22N2O3 — CID 5057406
1-cyclohexyl-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea (PubChem CID 5057406) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea.
| Compound Name | 1-cyclohexyl-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 5057406 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-cyclohexyl-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)urea |
| SMILES | O=C(NCC1COc2ccccc2O1)NC1CCCCC1 |
| InChI | InChI=1S/C16H22N2O3/c19-16(18-12-6-2-1-3-7-12)17-10-13-11-20-14-8-4-5-9-15(14)21-13/h4-5,8-9,12-13H,1-3,6-7,10-11H2,(H2,17,18,19) |
| InChIKey | YXXKSUVQKHWIJY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |