C13H16N2O2S — CID 7944367
1-cyclopropyl-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea (PubChem CID 7944367) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea |
|---|---|
| PubChem CID | 7944367 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-cyclopropyl-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1COc2ccccc2O1)NC1CC1 |
| InChI | InChI=1S/C13H16N2O2S/c18-13(15-9-5-6-9)14-7-10-8-16-11-3-1-2-4-12(11)17-10/h1-4,9-10H,5-8H2,(H2,14,15,18)/t10-/m1/s1 |
| InChIKey | WEHMWDHVOKSMHW-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|