C17H15ClN2O3S — CID 2821754
4-chloro-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioyl)benzamide (PubChem CID 2821754) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioyl)benzamide.
| Compound Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 2821754 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NCC1COc2ccccc2O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-12-7-5-11(6-8-12)16(21)20-17(24)19-9-13-10-22-14-3-1-2-4-15(14)23-13/h1-8,13H,9-10H2,(H2,19,20,21,24) |
| InChIKey | HFYBQLDXXLILGQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|