C16H14Cl2N2O2S — CID 55433827
1-(3,5-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)thiourea (PubChem CID 55433827) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 55433827 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)thiourea |
| SMILES | S=C(NCC1COc2ccccc2O1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O2S/c17-10-5-11(18)7-12(6-10)20-16(23)19-8-13-9-21-14-3-1-2-4-15(14)22-13/h1-7,13H,8-9H2,(H2,19,20,23) |
| InChIKey | GVIHVNWPZLMJJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|