C17H15BrN2O3S — CID 40562277
2-bromo-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylcarbamothioyl]benzamide (PubChem CID 40562277) has the molecular formula C17H15BrN2O3S and a molecular weight of 407.29 g/mol. Its IUPAC name is 2-bromo-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylcarbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 40562277 |
| Molecular Formula | C17H15BrN2O3S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 2-bromo-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylcarbamothioyl]benzamide |
| SMILES | O=C(NC(=S)NC[C@@H]1COc2ccccc2O1)c1ccccc1Br |
| InChI | InChI=1S/C17H15BrN2O3S/c18-13-6-2-1-5-12(13)16(21)20-17(24)19-9-11-10-22-14-7-3-4-8-15(14)23-11/h1-8,11H,9-10H2,(H2,19,20,21,24)/t11-/m1/s1 |
| InChIKey | BRBVSWUXBLDYJG-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|