C13H16N2O4S — CID 127055437
3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioylamino)propanoic acid (PubChem CID 127055437) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioylamino)propanoic acid.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 127055437 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamothioylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=S)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C13H16N2O4S/c16-12(17)5-6-14-13(20)15-7-9-8-18-10-3-1-2-4-11(10)19-9/h1-4,9H,5-8H2,(H,16,17)(H2,14,15,20) |
| InChIKey | KNIGQNIMSLVXNJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|