C18H20N2O3S — CID 8749780
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 8749780) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8749780 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NC[C@@H]2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-21-14-8-6-13(7-9-14)10-19-18(24)20-11-15-12-22-16-4-2-3-5-17(16)23-15/h2-9,15H,10-12H2,1H3,(H2,19,20,24)/t15-/m1/s1 |
| InChIKey | ONPKXMCVBFLKCM-OAHLLOKOSA-N |
| XLogP | 2.50 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|