C19H23N3O6S — CID 36509968
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea (PubChem CID 36509968) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 36509968 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)NC[C@@H]2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C19H23N3O6S/c1-26-14-6-8-16(9-7-14)29(24,25)22-11-10-20-19(23)21-12-15-13-27-17-4-2-3-5-18(17)28-15/h2-9,15,22H,10-13H2,1H3,(H2,20,21,23)/t15-/m1/s1 |
| InChIKey | CYOLLJBJPTXVSW-OAHLLOKOSA-N |
| XLogP | 1.11 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|