C14H21N3O5S — CID 38217151
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[3-(methanesulfonamido)propyl]urea (PubChem CID 38217151) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[3-(methanesulfonamido)propyl]urea.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[3-(methanesulfonamido)propyl]urea |
|---|---|
| PubChem CID | 38217151 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-[3-(methanesulfonamido)propyl]urea |
| SMILES | CS(=O)(=O)NCCCNC(=O)NC[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C14H21N3O5S/c1-23(19,20)17-8-4-7-15-14(18)16-9-11-10-21-12-5-2-3-6-13(12)22-11/h2-3,5-6,11,17H,4,7-10H2,1H3,(H2,15,16,18)/t11-/m1/s1 |
| InChIKey | BARFYCMKQNMSTJ-LLVKDONJSA-N |
| XLogP | 0.06 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|