C17H25N3O5 — CID 108864562
tert-butyl N-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoylamino)ethyl]carbamate (PubChem CID 108864562) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is tert-butyl N-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108864562 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl N-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C17H25N3O5/c1-17(2,3)25-16(22)19-9-8-18-15(21)20-10-12-11-23-13-6-4-5-7-14(13)24-12/h4-7,12H,8-11H2,1-3H3,(H,19,22)(H2,18,20,21) |
| InChIKey | QVTKRCKMMSOADF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|