C17H22N2O2S — CID 98309854
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea (PubChem CID 98309854) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea |
|---|---|
| PubChem CID | 98309854 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1COc2ccccc2O1)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H22N2O2S/c22-17(19-14-8-11-5-6-12(14)7-11)18-9-13-10-20-15-3-1-2-4-16(15)21-13/h1-4,11-14H,5-10H2,(H2,18,19,22)/t11-,12-,13+,14-/m0/s1 |
| InChIKey | GRGQVGNDBSEXTN-FQUUOJAGSA-N |
| XLogP | 2.48 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|