C17H17N3O4 — CID 38169413
1-benzamido-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]urea (PubChem CID 38169413) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-benzamido-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]urea.
| Compound Name | 1-benzamido-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 38169413 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-benzamido-3-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1COc2ccccc2O1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O4/c21-16(12-6-2-1-3-7-12)19-20-17(22)18-10-13-11-23-14-8-4-5-9-15(14)24-13/h1-9,13H,10-11H2,(H,19,21)(H2,18,20,22)/t13-/m0/s1 |
| InChIKey | YXOYVCXDVLZSTH-ZDUSSCGKSA-N |
| XLogP | 1.47 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|