C16H15IN2O3 — CID 108869065
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-(2-iodophenyl)urea (PubChem CID 108869065) has the molecular formula C16H15IN2O3 and a molecular weight of 410.21 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-(2-iodophenyl)urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-(2-iodophenyl)urea |
|---|---|
| PubChem CID | 108869065 |
| Molecular Formula | C16H15IN2O3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-(2-iodophenyl)urea |
| SMILES | O=C(NCC1COc2ccccc2O1)Nc1ccccc1I |
| InChI | InChI=1S/C16H15IN2O3/c17-12-5-1-2-6-13(12)19-16(20)18-9-11-10-21-14-7-3-4-8-15(14)22-11/h1-8,11H,9-10H2,(H2,18,19,20) |
| InChIKey | MIHFPNWYUJUTOC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|