C18H17N3O3 — CID 129352572
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(1H-indol-4-yl)urea (PubChem CID 129352572) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(1H-indol-4-yl)urea.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(1H-indol-4-yl)urea |
|---|---|
| PubChem CID | 129352572 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(1H-indol-4-yl)urea |
| SMILES | O=C(NC[C@@H]1COc2ccccc2O1)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C18H17N3O3/c22-18(21-15-5-3-4-14-13(15)8-9-19-14)20-10-12-11-23-16-6-1-2-7-17(16)24-12/h1-9,12,19H,10-11H2,(H2,20,21,22)/t12-/m1/s1 |
| InChIKey | QUPDRYNBTSLSHW-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |