C23H23N3O3 — CID 98305178
(2S)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-quinolin-6-ylbutanamide (PubChem CID 98305178) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2S)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-quinolin-6-ylbutanamide.
| Compound Name | (2S)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-quinolin-6-ylbutanamide |
|---|---|
| PubChem CID | 98305178 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-quinolin-6-ylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccc2ncccc2c1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C23H23N3O3/c1-2-18(21(27)25-16-9-10-17-15(12-16)4-3-11-24-17)26-22(28)19-13-5-6-14(8-7-13)20(19)23(26)29/h3-6,9-14,18-20H,2,7-8H2,1H3,(H,25,27)/t13-,14-,18-,19-,20+/m0/s1 |
| InChIKey | IFKVMBNUMNMBCY-TXGHUNKASA-N |
| XLogP | 3.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|