C15H16N4O3S — CID 100891522
(2R)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100891522) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2R)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100891522 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (2R)-2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-N-(1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1nncs1)N1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C15H16N4O3S/c1-7(12(20)17-15-18-16-6-23-15)19-13(21)10-8-2-3-9(5-4-8)11(10)14(19)22/h2-3,6-11H,4-5H2,1H3,(H,17,18,20)/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | NHGXBDFHLKYHCN-ZKKRXERASA-N |
| XLogP | 1.06 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|