C24H23N3O3 — CID 66491172
1-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]-3-(4-methylphenyl)urea (PubChem CID 66491172) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 66491172 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-14-2-8-18(9-3-14)26-24(30)25-13-15-4-10-19(11-5-15)27-22(28)20-16-6-7-17(12-16)21(20)23(27)29/h2-11,16-17,20-21H,12-13H2,1H3,(H2,25,26,30) |
| InChIKey | LZXDJUABLISXTR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|