C23H20ClN3O3 — CID 66491102
1-(4-chlorophenyl)-3-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]urea (PubChem CID 66491102) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 66491102 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O3/c24-16-5-7-17(8-6-16)26-23(30)25-12-13-1-9-18(10-2-13)27-21(28)19-14-3-4-15(11-14)20(19)22(27)29/h1-10,14-15,19-20H,11-12H2,(H2,25,26,30) |
| InChIKey | ZKYJEWGAXTXVDB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|