C16H20N6O3 — CID 136549426
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methylbenzotriazol-5-yl)acetamide (PubChem CID 136549426) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methylbenzotriazol-5-yl)acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methylbenzotriazol-5-yl)acetamide |
|---|---|
| PubChem CID | 136549426 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(1-methylbenzotriazol-5-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2ccc3c(c2)nnn3C)C1=O |
| InChI | InChI=1S/C16H20N6O3/c1-4-16(5-2)14(24)22(15(25)18-16)9-13(23)17-10-6-7-12-11(8-10)19-20-21(12)3/h6-8H,4-5,9H2,1-3H3,(H,17,23)(H,18,25) |
| InChIKey | RZIIEFYXOKVHPK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|