C15H18BrN3O3 — CID 2708881
N-(3-bromophenyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 2708881) has the molecular formula C15H18BrN3O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 2708881 |
| Molecular Formula | C15H18BrN3O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-(3-bromophenyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C15H18BrN3O3/c1-3-15(4-2)13(21)19(14(22)18-15)9-12(20)17-11-7-5-6-10(16)8-11/h5-8H,3-4,9H2,1-2H3,(H,17,20)(H,18,22) |
| InChIKey | HPQRSQGKUZIREH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|