C14H18BrN3O2 — CID 63602299
N-(3-bromophenyl)-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide (PubChem CID 63602299) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 63602299 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-(3-bromophenyl)-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide |
| SMILES | CC1(C)NCCN(CC(=O)Nc2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C14H18BrN3O2/c1-14(2)13(20)18(7-6-16-14)9-12(19)17-11-5-3-4-10(15)8-11/h3-5,8,16H,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | UQLALRREOVCVGB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |