C13H12BrN3O3 — CID 60697679
N-(3-bromophenyl)-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide (PubChem CID 60697679) has the molecular formula C13H12BrN3O3 and a molecular weight of 338.16 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60697679 |
| Molecular Formula | C13H12BrN3O3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-(3-bromophenyl)-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cn1ccc(=O)n(CC(=O)Nc2cccc(Br)c2)c1=O |
| InChI | InChI=1S/C13H12BrN3O3/c1-16-6-5-12(19)17(13(16)20)8-11(18)15-10-4-2-3-9(14)7-10/h2-7H,8H2,1H3,(H,15,18) |
| InChIKey | AZLIANOYVRYNDQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |