C18H21BrN2O3 — CID 19241341
N-(3-bromophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide (PubChem CID 19241341) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide |
|---|---|
| PubChem CID | 19241341 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-(3-bromophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide |
| SMILES | CC12CCC(C(=O)N(CC(=O)Nc3cccc(Br)c3)C1=O)C2(C)C |
| InChI | InChI=1S/C18H21BrN2O3/c1-17(2)13-7-8-18(17,3)16(24)21(15(13)23)10-14(22)20-12-6-4-5-11(19)9-12/h4-6,9,13H,7-8,10H2,1-3H3,(H,20,22) |
| InChIKey | QMKJVUYASUNJST-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|