C18H21FN2O3 — CID 19241339
N-(4-fluorophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide (PubChem CID 19241339) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide |
|---|---|
| PubChem CID | 19241339 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)acetamide |
| SMILES | CC12CCC(C(=O)N(CC(=O)Nc3ccc(F)cc3)C1=O)C2(C)C |
| InChI | InChI=1S/C18H21FN2O3/c1-17(2)13-8-9-18(17,3)16(24)21(15(13)23)10-14(22)20-12-6-4-11(19)5-7-12/h4-7,13H,8-10H2,1-3H3,(H,20,22) |
| InChIKey | XOSKSWWGGQDJJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|