C24H32N2O5 — CID 19241970
2-methylpropyl 4-[3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoylamino]benzoate (PubChem CID 19241970) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoylamino]benzoate.
| Compound Name | 2-methylpropyl 4-[3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19241970 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-methylpropyl 4-[3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoylamino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(NC(=O)CCN2C(=O)C3CCC(C)(C2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O5/c1-15(2)14-31-21(29)16-6-8-17(9-7-16)25-19(27)11-13-26-20(28)18-10-12-24(5,22(26)30)23(18,3)4/h6-9,15,18H,10-14H2,1-5H3,(H,25,27) |
| InChIKey | WXBSGBNWSZNAIU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|