C22H30N2O3 — CID 19241944
3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 19241944) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 19241944 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCN2C(=O)C3CCC(C)(C2=O)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-13-11-14(2)18(15(3)12-13)23-17(25)8-10-24-19(26)16-7-9-22(6,20(24)27)21(16,4)5/h11-12,16H,7-10H2,1-6H3,(H,23,25) |
| InChIKey | VUTAINRBQDWMTB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|