C17H20N4O4 — CID 29367214
(2R)-2-acetamido-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]propanamide (PubChem CID 29367214) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]propanamide.
| Compound Name | (2R)-2-acetamido-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 29367214 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (2R)-2-acetamido-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]propanamide |
| SMILES | CC(=O)N[C@H](C)C(=O)Nc1ccc(NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H20N4O4/c1-11(19-12(2)22)16(23)20-13-5-7-14(8-6-13)21-17(24)18-10-15-4-3-9-25-15/h3-9,11H,10H2,1-2H3,(H,19,22)(H,20,23)(H2,18,21,24)/t11-/m1/s1 |
| InChIKey | GUYMGRTWYDKPJK-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |