C20H26N4O5 — CID 55560299
tert-butyl N-[1-[4-(furan-2-ylmethylcarbamoylamino)anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 55560299) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(furan-2-ylmethylcarbamoylamino)anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(furan-2-ylmethylcarbamoylamino)anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55560299 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tert-butyl N-[1-[4-(furan-2-ylmethylcarbamoylamino)anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Nc1ccc(NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H26N4O5/c1-13(22-19(27)29-20(2,3)4)17(25)23-14-7-9-15(10-8-14)24-18(26)21-12-16-6-5-11-28-16/h5-11,13H,12H2,1-4H3,(H,22,27)(H,23,25)(H2,21,24,26) |
| InChIKey | MOOPVBNTMCRBJV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |