C19H23N3O5 — CID 9081148
tert-butyl N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamate (PubChem CID 9081148) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9081148 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl N-[4-[[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-19(2,3)27-18(25)22-14-8-6-13(7-9-14)17(24)21-12-16(23)20-11-15-5-4-10-26-15/h4-10H,11-12H2,1-3H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | XJPFUPKZPDWKRT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |