C14H14N4O4S — CID 126142806
1-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-(2-hydroxyethyl)urea (PubChem CID 126142806) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 126142806 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1ccc2nc(N3C(=O)CCC3=O)sc2c1 |
| InChI | InChI=1S/C14H14N4O4S/c19-6-5-15-13(22)16-8-1-2-9-10(7-8)23-14(17-9)18-11(20)3-4-12(18)21/h1-2,7,19H,3-6H2,(H2,15,16,22) |
| InChIKey | UYVZEKFUGWDGIE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|