C22H27N3O3S3 — CID 3316015
N-(furan-2-ylmethyl)-N'-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]pentanediamide (PubChem CID 3316015) has the molecular formula C22H27N3O3S3 and a molecular weight of 477.68 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]pentanediamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]pentanediamide |
|---|---|
| PubChem CID | 3316015 |
| Molecular Formula | C22H27N3O3S3 |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]pentanediamide |
| SMILES | CC(C)SCCSc1nc2ccc(NC(=O)CCCC(=O)NCc3ccco3)cc2s1 |
| InChI | InChI=1S/C22H27N3O3S3/c1-15(2)29-11-12-30-22-25-18-9-8-16(13-19(18)31-22)24-21(27)7-3-6-20(26)23-14-17-5-4-10-28-17/h4-5,8-10,13,15H,3,6-7,11-12,14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | GZWGUWDMRRDUPJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|