C14H19N3S4 — CID 3740552
1-methyl-3-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]thiourea (PubChem CID 3740552) has the molecular formula C14H19N3S4 and a molecular weight of 357.60 g/mol. Its IUPAC name is 1-methyl-3-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]thiourea.
| Compound Name | 1-methyl-3-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]thiourea |
|---|---|
| PubChem CID | 3740552 |
| Molecular Formula | C14H19N3S4 |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-methyl-3-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]thiourea |
| SMILES | CNC(=S)Nc1ccc2nc(SCCSC(C)C)sc2c1 |
| InChI | InChI=1S/C14H19N3S4/c1-9(2)19-6-7-20-14-17-11-5-4-10(8-12(11)21-14)16-13(18)15-3/h4-5,8-9H,6-7H2,1-3H3,(H2,15,16,18) |
| InChIKey | IRVHDVBSTGBCPB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|