C16H18F3N3O2S3 — CID 3686055
2-formamido-4-methylsulfanyl-N-[2-(3,3,3-trifluoropropylsulfanyl)-1,3-benzothiazol-6-yl]butanamide (PubChem CID 3686055) has the molecular formula C16H18F3N3O2S3 and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-formamido-4-methylsulfanyl-N-[2-(3,3,3-trifluoropropylsulfanyl)-1,3-benzothiazol-6-yl]butanamide.
| Compound Name | 2-formamido-4-methylsulfanyl-N-[2-(3,3,3-trifluoropropylsulfanyl)-1,3-benzothiazol-6-yl]butanamide |
|---|---|
| PubChem CID | 3686055 |
| Molecular Formula | C16H18F3N3O2S3 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-formamido-4-methylsulfanyl-N-[2-(3,3,3-trifluoropropylsulfanyl)-1,3-benzothiazol-6-yl]butanamide |
| SMILES | CSCCC(NC=O)C(=O)Nc1ccc2nc(SCCC(F)(F)F)sc2c1 |
| InChI | InChI=1S/C16H18F3N3O2S3/c1-25-6-4-12(20-9-23)14(24)21-10-2-3-11-13(8-10)27-15(22-11)26-7-5-16(17,18)19/h2-3,8-9,12H,4-7H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | MMMRUHNYLHBWSX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|