C14H19N3OS2 — CID 60853488
2-amino-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)hexanamide (PubChem CID 60853488) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-amino-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)hexanamide.
| Compound Name | 2-amino-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)hexanamide |
|---|---|
| PubChem CID | 60853488 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-amino-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)hexanamide |
| SMILES | CCCCC(N)C(=O)Nc1ccc2nc(SC)sc2c1 |
| InChI | InChI=1S/C14H19N3OS2/c1-3-4-5-10(15)13(18)16-9-6-7-11-12(8-9)20-14(17-11)19-2/h6-8,10H,3-5,15H2,1-2H3,(H,16,18) |
| InChIKey | ZHDSZHWYECKRSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |