C16H24N2S2 — CID 63426863
2-methylsulfanyl-N-octan-2-yl-1,3-benzothiazol-6-amine (PubChem CID 63426863) has the molecular formula C16H24N2S2 and a molecular weight of 308.52 g/mol. Its IUPAC name is 2-methylsulfanyl-N-octan-2-yl-1,3-benzothiazol-6-amine.
| Compound Name | 2-methylsulfanyl-N-octan-2-yl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 63426863 |
| Molecular Formula | C16H24N2S2 |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-methylsulfanyl-N-octan-2-yl-1,3-benzothiazol-6-amine |
| SMILES | CCCCCCC(C)Nc1ccc2nc(SC)sc2c1 |
| InChI | InChI=1S/C16H24N2S2/c1-4-5-6-7-8-12(2)17-13-9-10-14-15(11-13)20-16(18-14)19-3/h9-12,17H,4-8H2,1-3H3 |
| InChIKey | MNHBLMZQNAPNQR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|