C24H44N2 — CID 98160565
1-N,4-N-bis[(2R)-nonan-2-yl]benzene-1,4-diamine (PubChem CID 98160565) has the molecular formula C24H44N2 and a molecular weight of 360.63 g/mol. Its IUPAC name is 1-N,4-N-bis[(2R)-nonan-2-yl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(2R)-nonan-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 98160565 |
| Molecular Formula | C24H44N2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.35 |
| IUPAC Name | 1-N,4-N-bis[(2R)-nonan-2-yl]benzene-1,4-diamine |
| SMILES | CCCCCCC[C@@H](C)Nc1ccc(N[C@H](C)CCCCCCC)cc1 |
| InChI | InChI=1S/C24H44N2/c1-5-7-9-11-13-15-21(3)25-23-17-19-24(20-18-23)26-22(4)16-14-12-10-8-6-2/h17-22,25-26H,5-16H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | VDRDLXVBEGDBKO-FGZHOGPDSA-N |
| XLogP | 8.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|