C45H78N4S — CID 19832459
1,3-di(octan-2-yl)-1,3-bis[4-(octan-2-ylamino)phenyl]thiourea (PubChem CID 19832459) has the molecular formula C45H78N4S and a molecular weight of 707.21 g/mol. Its IUPAC name is 1,3-di(octan-2-yl)-1,3-bis[4-(octan-2-ylamino)phenyl]thiourea.
| Compound Name | 1,3-di(octan-2-yl)-1,3-bis[4-(octan-2-ylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 19832459 |
| Molecular Formula | C45H78N4S |
| Molecular Weight | 707.21 g/mol |
| Exact Mass | 706.59 |
| IUPAC Name | 1,3-di(octan-2-yl)-1,3-bis[4-(octan-2-ylamino)phenyl]thiourea |
| SMILES | CCCCCCC(C)Nc1ccc(N(C(=S)N(c2ccc(NC(C)CCCCCC)cc2)C(C)CCCCCC)C(C)CCCCCC)cc1 |
| InChI | InChI=1S/C45H78N4S/c1-9-13-17-21-25-37(5)46-41-29-33-43(34-30-41)48(39(7)27-23-19-15-11-3)45(50)49(40(8)28-24-20-16-12-4)44-35-31-42(32-36-44)47-38(6)26-22-18-14-10-2/h29-40,46-47H,9-28H2,1-8H3 |
| InChIKey | BCIDNTKDFQPHBY-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.21 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|