C13H18N2S3 — CID 103087444
2-methylsulfanyl-N-(4-methylsulfanylbutyl)-1,3-benzothiazol-6-amine (PubChem CID 103087444) has the molecular formula C13H18N2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(4-methylsulfanylbutyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-methylsulfanyl-N-(4-methylsulfanylbutyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 103087444 |
| Molecular Formula | C13H18N2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-methylsulfanyl-N-(4-methylsulfanylbutyl)-1,3-benzothiazol-6-amine |
| SMILES | CSCCCCNc1ccc2nc(SC)sc2c1 |
| InChI | InChI=1S/C13H18N2S3/c1-16-8-4-3-7-14-10-5-6-11-12(9-10)18-13(15-11)17-2/h5-6,9,14H,3-4,7-8H2,1-2H3 |
| InChIKey | BQMHXDDQOQPGCY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|